CymitQuimica logo

CAS 948592-75-4

:

B-(2-Amino-4-methoxyphenyl)boronic acid

Description:
B-(2-Amino-4-methoxyphenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to an aromatic ring that contains an amino group and a methoxy substituent. This compound typically exhibits a white to off-white crystalline solid form and is soluble in polar solvents such as water and alcohols, owing to the presence of the boronic acid group. It is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including medicinal chemistry and materials science. The amino group can participate in hydrogen bonding and may enhance the compound's reactivity and interaction with biological targets. Additionally, the methoxy group can influence the electronic properties of the aromatic ring, potentially affecting the compound's reactivity and stability. B-(2-Amino-4-methoxyphenyl)boronic acid is often utilized in the synthesis of complex organic molecules and as a building block in drug discovery, particularly in the development of inhibitors for certain enzymes.
Formula:C7H10BNO3
InChI:InChI=1S/C7H10BNO3/c1-12-5-2-3-6(8(10)11)7(9)4-5/h2-4,10-11H,9H2,1H3
InChI key:InChIKey=QCTZXOWPLSEKSA-UHFFFAOYSA-N
SMILES:B(O)(O)C1=C(N)C=C(OC)C=C1
Synonyms:
  • (2-Amino-4-methoxyphenyl)boronic acid
  • Boronic acid, B-(2-amino-4-methoxyphenyl)-
  • B-(2-Amino-4-methoxyphenyl)boronic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.