
CAS 948593-46-2
:1-Ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-4-amine
Description:
1-Ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-4-amine is a chemical compound characterized by its unique structure, which includes a pyrazole ring and a boron-containing dioxaborolane moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of the amine and boron functional groups. The dioxaborolane group can participate in various chemical reactions, making this compound of interest in synthetic organic chemistry and medicinal chemistry. Its structure suggests potential applications in drug development, particularly in the design of compounds that may interact with biological targets. Additionally, the presence of the ethyl group may influence its lipophilicity and biological activity. Overall, this compound represents a class of boron-containing heterocycles that are valuable for their reactivity and potential applications in various fields, including pharmaceuticals and materials science.
Formula:C11H20BN3O2
InChI:InChI=1S/C11H20BN3O2/c1-6-15-9(8(13)7-14-15)12-16-10(2,3)11(4,5)17-12/h7H,6,13H2,1-5H3
InChI key:InChIKey=GHKSDJGAHHBDOS-UHFFFAOYSA-N
SMILES:C(C)N1C(B2OC(C)(C)C(C)(C)O2)=C(N)C=N1
Synonyms:- 1-Ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-4-amine
- 1-Ethyl-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-4-amine
- 1H-Pyrazol-4-amine, 1-ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Ethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-4-amine
CAS:Formula:C11H20BN3O2Molecular weight:237.1064

