
CAS 948593-64-4
:B-(3-Amino-5-chloro-2-pyridinyl)boronic acid
Description:
B-(3-Amino-5-chloro-2-pyridinyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyridine ring that contains an amino and a chloro substituent. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar solvents like water and methanol, and may have moderate stability under standard conditions. The boronic acid moiety allows for participation in various chemical reactions, including Suzuki coupling, making it valuable in organic synthesis and medicinal chemistry. The amino group can engage in hydrogen bonding and may influence the compound's reactivity and interaction with biological targets. Additionally, the presence of the chlorine atom can affect the electronic properties of the molecule, potentially enhancing its biological activity or selectivity. Overall, B-(3-Amino-5-chloro-2-pyridinyl)boronic acid is a versatile compound with applications in drug development and material science.
Formula:C5H6BClN2O2
InChI:InChI=1S/C5H6BClN2O2/c7-3-1-4(8)5(6(10)11)9-2-3/h1-2,10-11H,8H2
InChI key:InChIKey=QMQBKEZDGSJLIR-UHFFFAOYSA-N
SMILES:B(O)(O)C1=C(N)C=C(Cl)C=N1
Synonyms:- Boronic acid, B-(3-amino-5-chloro-2-pyridinyl)-
- 3-Amino-5-chloropyridin-2-ylboronic acid
- B-(3-Amino-5-chloro-2-pyridinyl)boronic acid
- (3-Amino-5-chloropyridin-2-yl)boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.