CymitQuimica logo

CAS 948593-65-5

:

B-(3-Amino-5-methoxy-2-pyridinyl)boronic acid

Description:
B-(3-Amino-5-methoxy-2-pyridinyl)boronic acid, with the CAS number 948593-65-5, is a boronic acid derivative characterized by the presence of a pyridine ring substituted with an amino group and a methoxy group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The amino group can participate in hydrogen bonding and may enhance the compound's solubility in polar solvents, while the methoxy group can influence its electronic properties and reactivity. Additionally, the presence of the boron atom contributes to its unique reactivity profile, allowing it to act as a ligand in coordination chemistry. Overall, this compound is of interest in the development of pharmaceuticals and as a building block in organic synthesis due to its functional groups and boron chemistry.
Formula:C6H9BN2O3
InChI:InChI=1S/C6H9BN2O3/c1-12-4-2-5(8)6(7(10)11)9-3-4/h2-3,10-11H,8H2,1H3
InChI key:InChIKey=MQIWKQCFVRMMCU-UHFFFAOYSA-N
SMILES:B(O)(O)C1=C(N)C=C(OC)C=N1
Synonyms:
  • B-(3-Amino-5-methoxy-2-pyridinyl)boronic acid
  • (3-Amino-5-methoxypyridin-2-yl)boronic acid
  • 3-Amino-5-methoxypyridine-2-boronic acid
  • Boronic acid, B-(3-amino-5-methoxy-2-pyridinyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.