CAS 948593-71-3

5-Chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinamine

Description:

5-Chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinamine is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with an amino group and a chloro group, as well as a dioxaborolane moiety. The presence of the chloro substituent enhances its reactivity, making it useful in various synthetic applications, particularly in medicinal chemistry and organic synthesis. The dioxaborolane group contributes to its potential as a boron-containing compound, which can participate in cross-coupling reactions, a key process in the formation of carbon-carbon bonds. This compound is likely to exhibit moderate to high solubility in polar organic solvents, and its stability may be influenced by environmental factors such as moisture and temperature. Additionally, due to the presence of the boron atom, it may exhibit unique properties in terms of coordination chemistry and reactivity with nucleophiles. Overall, this compound is of interest for its potential applications in drug development and materials science.

Formula: C₁₁H₁₆BClN₂O₂

InChI: InChI=1S/C11H16BClN2O2/c1-10(2)11(3,4)17-12(16-10)9-8(14)5-7(13)6-15-9/h5-6H,14H2,1-4H3

InChI key: InChIKey=DWPGKRLAAFMWSN-UHFFFAOYSA-N

SMILES: NC1=C(N=CC(Cl)=C1)B2OC(C)(C)C(C)(C)O2

Synonyms:

• 3-Pyridinamine, 5-chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
• 5-Chloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinamine
• 3-Amino-5-chloropyridine-2-boronic acid pinacol ester