CAS 948595-05-9

(R)-2-(Methoxydiphenylmethyl)pyrrolidine

Description:

(R)-2-(Methoxydiphenylmethyl)pyrrolidine, with the CAS number 948595-05-9, is a chiral organic compound characterized by its pyrrolidine backbone, which is a five-membered nitrogen-containing heterocycle. The presence of a methoxydiphenylmethyl group contributes to its unique structural and electronic properties, influencing its reactivity and interactions. This compound is typically studied in the context of medicinal chemistry and drug development due to its potential biological activity, particularly in relation to its stereochemistry, which can significantly affect pharmacological effects. The methoxy group enhances solubility and may participate in hydrogen bonding, while the diphenylmethyl moiety can provide steric hindrance and influence binding interactions with biological targets. As a chiral molecule, it may exhibit different properties and activities depending on its enantiomeric form, making it of interest in asymmetric synthesis and chiral resolution processes. Overall, (R)-2-(Methoxydiphenylmethyl)pyrrolidine represents a valuable compound for research in various chemical and pharmaceutical applications.

Formula: C₁₈H₂₁NO

InChI: InChI=1/C18H21NO/c1-20-18(17-13-8-14-19-17,15-9-4-2-5-10-15)16-11-6-3-7-12-16/h2-7,9-12,17,19H,8,13-14H2,1H3/t17-/m1/s1

SMILES: COC(c1ccccc1)(c1ccccc1)[C@H]1CCCN1

Synonyms:

• (2R)-2-[methoxy(diphenyl)methyl]pyrrolidine

(R)-2-(Methoxydiphenylmethyl)pyrrolidine

Controlled Product

CAS: 948595-05-9

Please enquire for more information about (R)-2-(Methoxydiphenylmethyl)pyrrolidine including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₁₈H₂₁NO

Purity: Min. 95%

Molecular weight: 267.37 g/mol

Ref: 3D-FM148783