
CAS 948595-08-2
:O-[N-(6-Maleimidohexanoyl)aminoethyl]-Oμ-(2-carboxyethyl)polyethylene glycol 3000
Description:
O-[N-(6-Maleimidohexanoyl)aminoethyl]-Oμ-(2-carboxyethyl)polyethylene glycol 3000, commonly referred to as a PEGylated compound, is a synthetic polymer that combines polyethylene glycol (PEG) with functional groups for bioconjugation. The presence of the maleimide group allows for selective conjugation to thiol-containing molecules, making it useful in biochemistry and drug delivery applications. The carboxyethyl groups enhance solubility and biocompatibility, while the PEG backbone contributes to reduced immunogenicity and increased circulation time in biological systems. This compound typically exhibits low toxicity and is soluble in aqueous environments, making it suitable for various biomedical applications, including the development of targeted therapies and diagnostic agents. Its molecular weight of approximately 3000 Da indicates a moderate size, which can influence its pharmacokinetics and biodistribution. Overall, this compound is valuable in the field of drug development and protein engineering due to its ability to improve the stability and efficacy of therapeutic agents.
Formula:(C2H4O)nC15H22N2O6
Synonyms:- O-[N-(6-Maleimidohexanoyl)aminoethyl]-Oμ-(2-carboxyethyl)polyethylene glycol
- Poly(oxy-1,2-ethanediyl), α-(2-carboxyethyl)-ω-[2-[[6-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)-1-oxohexyl]amino]ethoxy]-
- O-[N-(6-Maleimidohexanoyl)aminoethyl]-Oμ-(2-carboxyethyl)polyethylene glycol 3000
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.