CymitQuimica logo

CAS 948595-10-6

:

Poly(oxy-1,2-ethanediyl), α-[3-[(2,5-dioxo-1-pyrrolidinyl)oxy]-3-oxopropyl]-ω-[2-[[5-[(3aS,4S,6aR)-hexahydro-2-oxo-1H-thieno[3,4-d]imidazol-4-yl]-1-oxopentyl]amino]ethoxy]-

Description:
The chemical substance known as Poly(oxy-1,2-ethanediyl), α-[3-[(2,5-dioxo-1-pyrrolidinyl)oxy]-3-oxopropyl]-ω-[2-[[5-[(3aS,4S,6aR)-hexahydro-2-oxo-1H-thieno[3,4-d]imidazol-4-yl]-1-oxopentyl]amino]ethoxy]- (CAS number 948595-10-6) is a complex polymeric compound characterized by its polyether backbone and functional groups that contribute to its bioactivity. This substance features a poly(ethylene glycol) structure, which enhances its solubility and biocompatibility, making it suitable for various applications in pharmaceuticals and biotechnology. The presence of pyrrolidinyl and thieno[3,4-d]imidazol moieties suggests potential interactions with biological targets, possibly influencing its pharmacological properties. Its molecular structure indicates that it may exhibit properties such as improved drug delivery, stability, and efficacy. Additionally, the compound's design may allow for specific interactions with cellular components, enhancing its therapeutic potential. Overall, this substance represents a sophisticated approach to drug design, integrating polymer chemistry with medicinal chemistry principles.
Formula:(C2H4O)nC19H28N4O7S
Synonyms:
  • Poly(oxy-1,2-ethanediyl), α-[3-[(2,5-dioxo-1-pyrrolidinyl)oxy]-3-oxopropyl]-ω-[2-[[5-[(3aS,4S,6aR)-hexahydro-2-oxo-1H-thieno[3,4-d]imidazol-4-yl]-1-oxopentyl]amino]ethoxy]-
  • EZ-Link NHS-PEG12-Biotin
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.