CAS 948595-12-8

N,N′-[1,4-Piperazinediyl-2,2,3,3,5,5,6,6-d8-bis(2,2,2-trichloroethylidene)]bis[formamide]

Description:

N,N′-[1,4-Piperazinediyl-2,2,3,3,5,5,6,6-d8-bis(2,2,2-trichloroethylidene)]bis[formamide] is a synthetic organic compound characterized by its complex structure, which includes a piperazine moiety and multiple trichloroethylidene groups. The presence of deuterium atoms (d8) indicates that this compound has been isotopically labeled, which can be useful in various analytical applications, including NMR spectroscopy. The formamide functional groups suggest that the compound may exhibit hydrogen bonding capabilities, influencing its solubility and reactivity. This compound is likely to be of interest in medicinal chemistry or materials science due to its unique structural features and potential biological activity. Its CAS number, 948595-12-8, allows for precise identification in chemical databases. As with many synthetic compounds, safety data sheets should be consulted for handling and toxicity information, as the presence of trichloroethylidene groups may pose environmental and health risks.

Formula: C₁₀H₆Cl₆D₈N₄O₂

InChI: InChI=1S/C10H14Cl6N4O2/c11-9(12,13)7(17-5-21)19-1-2-20(4-3-19)8(18-6-22)10(14,15)16/h5-8H,1-4H2,(H,17,21)(H,18,22)/i1D2,2D2,3D2,4D2

InChI key: InChIKey=RROQIUMZODEXOR-SVYQBANQSA-N

SMILES: C(C(Cl)(Cl)Cl)(NC=O)N1C(C(N(C(C(Cl)(Cl)Cl)NC=O)C(C1([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H]

Synonyms:

• Formamide, N,N′-[1,4-piperazinediyl-2,2,3,3,5,5,6,6-d8-bis(2,2,2-trichloroethylidene)]bis-
• N,N′-[1,4-Piperazinediyl-2,2,3,3,5,5,6,6-d8-bis(2,2,2-trichloroethylidene)]bis[formamide]