CymitQuimica logo

CAS 94882-74-3

:

benzyl N-(tert-butoxycarbonyl)-O-[(4-methylphenyl)sulfonyl]-L-serinate

Description:
Benzyl N-(tert-butoxycarbonyl)-O-[(4-methylphenyl)sulfonyl]-L-serinate is a synthetic organic compound that belongs to the class of amino acid derivatives. It features a benzyl group, a tert-butoxycarbonyl (Boc) protecting group, and a sulfonyl moiety attached to the serine amino acid structure. This compound is characterized by its complex structure, which includes multiple functional groups that contribute to its reactivity and solubility properties. The presence of the sulfonyl group enhances its potential for various chemical reactions, making it useful in organic synthesis, particularly in the field of peptide chemistry. The Boc group serves as a protective group for the amino functionality, allowing for selective reactions without interfering with the serine's hydroxyl group. Additionally, the compound's stability and solubility in organic solvents make it suitable for various applications in medicinal chemistry and drug development. Overall, this compound exemplifies the intricate design often required in the synthesis of biologically active molecules.
Formula:C22H27NO7S
InChI:InChI=1/C22H27NO7S/c1-16-10-12-18(13-11-16)31(26,27)29-15-19(23-21(25)30-22(2,3)4)20(24)28-14-17-8-6-5-7-9-17/h5-13,19H,14-15H2,1-4H3,(H,23,25)/t19-/m0/s1
SMILES:Cc1ccc(cc1)S(=O)(=O)OC[C@@H](C(=O)OCc1ccccc1)N=C(O)OC(C)(C)C
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.