CymitQuimica logo

CAS 94885-52-6

:

L-Proline, 5-oxo-, phenylmethyl ester

Description:
L-Proline, 5-oxo-, phenylmethyl ester, identified by the CAS number 94885-52-6, is a chemical compound that features a proline backbone modified with a phenylmethyl ester group and a keto functional group at the 5-position. This compound is part of the class of amino acid derivatives and is characterized by its structural complexity, which includes a cyclic structure due to the proline moiety. The presence of the phenylmethyl ester enhances its lipophilicity, potentially influencing its solubility and reactivity in various chemical environments. L-Proline itself is a non-essential amino acid, playing a crucial role in protein synthesis and cellular functions. The 5-oxo modification introduces a carbonyl group, which can participate in various chemical reactions, including nucleophilic attacks and condensation reactions. This compound may have applications in pharmaceuticals, particularly in the synthesis of peptide-based drugs or as intermediates in organic synthesis. Its specific properties, such as melting point, boiling point, and reactivity, would depend on the conditions under which it is studied or utilized.
Formula:C12H13NO3
InChI:InChI=1S/C12H13NO3/c14-11-7-6-10(13-11)12(15)16-8-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,13,14)/t10-/m0/s1
InChI key:NVKOCDGGRHAHOJ-JTQLQIEISA-N
SMILES:C1CC(=O)N[C@@H]1C(=O)OCC2=CC=CC=C2
Found 4 products.