CymitQuimica logo

CAS 948883-44-1

:

5-(5-Methyl-3-pyridinyl)-1H-pyrazol-3-amine

Description:
5-(5-Methyl-3-pyridinyl)-1H-pyrazol-3-amine, identified by its CAS number 948883-44-1, is a chemical compound characterized by its unique structural features, which include a pyrazole ring and a pyridine moiety. This compound typically exhibits properties associated with heterocyclic amines, such as potential biological activity and solubility in organic solvents. The presence of the methyl group on the pyridine ring can influence its electronic properties and reactivity. As a pyrazole derivative, it may participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. The compound's potential applications could span medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. Additionally, its stability and reactivity can be influenced by factors such as pH and temperature, making it important to consider these conditions in practical applications. Overall, 5-(5-Methyl-3-pyridinyl)-1H-pyrazol-3-amine represents a versatile structure with implications in both research and industry.
Formula:C9H10N4
InChI:InChI=1S/C9H10N4/c1-6-2-7(5-11-4-6)8-3-9(10)13-12-8/h2-5H,1H3,(H3,10,12,13)
InChI key:InChIKey=IDXBFGNQTSBWJZ-UHFFFAOYSA-N
SMILES:CC1=CC(=CN=C1)C=2NN=C(N)C2
Synonyms:
  • 5-(5-Methyl-3-pyridinyl)-1H-pyrazol-3-amine
  • 1H-Pyrazol-3-amine, 5-(5-methyl-3-pyridinyl)-
  • [5-(5-Methylpyridin-3-yl)-1H-pyrazol-3-yl]amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.