
CAS 948996-04-1
:6-Ethoxy-3-pyridazinemethanamine
Description:
6-Ethoxy-3-pyridazinemethanamine is a chemical compound characterized by its pyridazine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of the ethoxy group enhances its solubility in organic solvents and may influence its reactivity and biological activity. This compound is typically studied in the context of medicinal chemistry, where modifications to the pyridazine core can lead to various pharmacological properties. Its amine functional group suggests potential for hydrogen bonding and reactivity in further chemical transformations. The specific arrangement of substituents on the pyridazine ring can affect its electronic properties and interactions with biological targets. As with many organic compounds, the stability, reactivity, and potential applications of 6-Ethoxy-3-pyridazinemethanamine can be influenced by environmental factors such as pH and temperature. Further research is often necessary to fully elucidate its properties and potential uses in pharmaceuticals or other fields.
Formula:C7H11N3O
InChI:InChI=1S/C7H11N3O/c1-2-11-7-4-3-6(5-8)9-10-7/h3-4H,2,5,8H2,1H3
InChI key:InChIKey=WJHDYOWTNUWCRV-UHFFFAOYSA-N
SMILES:O(CC)C1=CC=C(CN)N=N1
Synonyms:- (6-Ethoxypyridazin-3-yl)methanamine
- 3-Pyridazinemethanamine, 6-ethoxy-
- 6-Ethoxy-3-pyridazinemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.