CAS 949-97-3

4-[(benzyloxy)methyl]-1,3-dioxolan-2-one

Description:

4-[(Benzyloxy)methyl]-1,3-dioxolan-2-one, with the CAS number 949-97-3, is a chemical compound characterized by its unique structure that includes a dioxolane ring and a benzyloxy group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its stability under standard conditions, making it useful in various chemical applications, particularly in organic synthesis. The presence of the dioxolan-2-one moiety suggests potential reactivity, particularly in nucleophilic substitution reactions, due to the electrophilic nature of the carbonyl group. Additionally, the benzyloxy group can enhance solubility in organic solvents and may influence the compound's reactivity and interaction with other chemical species. This compound may be utilized in the synthesis of more complex organic molecules, including pharmaceuticals and agrochemicals, due to its functional groups that can participate in further chemical transformations. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₁₁H₁₂O₄

InChI: InChI=1/C11H12O4/c12-11-14-8-10(15-11)7-13-6-9-4-2-1-3-5-9/h1-5,10H,6-8H2

SMILES: c1ccc(cc1)COCC1COC(=O)O1

4-[(Benzyloxy)methyl]-1,3-dioxolan-2-one

CAS: 949-97-3

4-[(Benzyloxy)methyl]-1,3-dioxolan-2-one

Molecular weight: 208.21g/mol

Ref: 54-OR7801T

1-Benzylglycerol-2,3-carbonate

Controlled Product

CAS: 949-97-3

Applications A potential antiparasitic agent.

Formula: C₁₁H₁₂O₄

Color and Shape: Neat

Molecular weight: 208.21

Ref: TR-B278000