CAS 949035-26-1

1-(6-Fluoro-1H-indol-3-yl)ethanone

Description:

1-(6-Fluoro-1H-indol-3-yl)ethanone, identified by its CAS number 949035-26-1, is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a fluorine atom at the 6-position of the indole ring contributes to its unique properties, potentially influencing its reactivity and biological activity. The ethanone functional group indicates that it contains a carbonyl group (C=O) adjacent to an ethyl group, which can enhance its reactivity in various chemical reactions, such as nucleophilic attacks. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in the synthesis of more complex molecules or as a precursor in the development of pharmaceuticals. As with many fluorinated compounds, it may also exhibit altered solubility and stability compared to its non-fluorinated counterparts, which can be advantageous in specific applications.

Formula: C₁₀H₈FNO

InChI: InChI=1S/C10H8FNO/c1-6(13)9-5-12-10-4-7(11)2-3-8(9)10/h2-5,12H,1H3

InChI key: InChIKey=UZFSNUWTPYUTNB-UHFFFAOYSA-N

SMILES: C(C)(=O)C=1C=2C(NC1)=CC(F)=CC2

Synonyms:

• 1-(6-Fluoro-1H-indol-3-yl)ethan-1-one
• Ethanone, 1-(6-fluoro-1H-indol-3-yl)-
• 1-(6-Fluoro-1H-indol-3-yl)ethanone
• 3-Acetyl-6-fluoroindole

1-(6-Fluoro-1H-indol-3-yl)ethan-1-one

Controlled Product

CAS: 949035-26-1

Versatile small molecule scaffold

Formula: C₁₀H₈FNO

Purity: Min. 95%

Molecular weight: 177.17 g/mol

Ref: 3D-ZMB03526