CAS 94909-90-7
:(1-methylpiperidin-2-yl)methyl hydroxy(diphenyl)acetate
Description:
(1-Methylpiperidin-2-yl)methyl hydroxy(diphenyl)acetate, with the CAS number 94909-90-7, is a chemical compound characterized by its complex structure, which includes a piperidine ring substituted with a methyl group and a hydroxy(diphenyl)acetate moiety. This compound typically exhibits properties associated with both amines and esters, such as potential solubility in organic solvents and the ability to participate in hydrogen bonding due to the presence of hydroxyl groups. Its molecular structure suggests it may have applications in medicinal chemistry, possibly as a pharmaceutical intermediate or active ingredient, given the presence of the piperidine ring, which is common in various bioactive compounds. Additionally, the diphenylacetate portion may contribute to its lipophilicity, influencing its pharmacokinetic properties. As with many organic compounds, its stability, reactivity, and biological activity would depend on specific environmental conditions and the presence of other functional groups. Safety and handling precautions should be observed, as with any chemical substance, particularly in laboratory or industrial settings.
Formula:C21H25NO3
InChI:InChI=1/C21H25NO3/c1-22-15-9-8-14-19(22)16-25-20(23)21(24,17-10-4-2-5-11-17)18-12-6-3-7-13-18/h2-7,10-13,19,24H,8-9,14-16H2,1H3
SMILES:CN1CCCCC1COC(=O)C(c1ccccc1)(c1ccccc1)O
Synonyms:- (1-Methyl-2-Piperidinyl)Methyl Hydroxy(Diphenyl)Acetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
N-Methylpiperidinyl-2-methyl Benzilate
CAS:Controlled ProductApplications N-Methylpiperidinyl-2-methyl Benzilate (cas# 94909-90-7) is a compound useful in organic synthesis.
Formula:C21H25NO3Color and Shape:NeatMolecular weight:339.43N-Methylpiperidinyl-2-methyl benzilate
CAS:Controlled ProductPlease enquire for more information about N-Methylpiperidinyl-2-methyl benzilate including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C21H25NO3Purity:Min. 95%Molecular weight:339.43 g/mol

