CymitQuimica logo

CAS 949096-01-9

:

4-[3-(methylamino)-1-(2-thienyl)propyl]naphthalen-1-ol hydrobromide

Description:
4-[3-(Methylamino)-1-(2-thienyl)propyl]naphthalen-1-ol hydrobromide is a chemical compound characterized by its complex structure, which includes a naphthalene moiety, a thienyl group, and a methylamino substituent. This compound is typically classified as an organic amine and may exhibit properties associated with both aromatic and aliphatic compounds due to its diverse functional groups. The presence of the hydroxyl group (–OH) suggests potential for hydrogen bonding, which can influence its solubility and reactivity. The hydrobromide salt form indicates that it is likely more stable and soluble in aqueous solutions compared to its free base form. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity. However, specific pharmacological properties, toxicity, and applications would require further investigation through empirical studies and literature review. As with any chemical, proper handling and safety protocols should be observed, especially in laboratory settings.
Formula:C18H20BrNOS
InChI:InChI=1/C18H19NOS.BrH/c1-19-11-10-16(18-7-4-12-21-18)14-8-9-17(20)15-6-3-2-5-13(14)15;/h2-9,12,16,19-20H,10-11H2,1H3;1H
SMILES:CNCCC(c1ccc(c2ccccc12)O)c1cccs1.Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.