CAS 949100-11-2

4-Fluoro-4-piperidinemethanol

Description:

4-Fluoro-4-piperidinemethanol is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. The presence of a fluorine atom at the fourth position of the piperidine ring significantly influences its chemical properties, including its reactivity and potential biological activity. The hydroxymethyl group (-CH2OH) at the same position enhances its polarity and solubility in polar solvents, making it suitable for various applications in medicinal chemistry and drug development. This compound may exhibit interesting pharmacological properties due to the combination of the piperidine structure and the fluorine substituent, which can affect its interaction with biological targets. Additionally, the presence of the hydroxymethyl group can facilitate hydrogen bonding, potentially influencing its binding affinity to receptors or enzymes. As with many fluorinated compounds, 4-Fluoro-4-piperidinemethanol may also exhibit unique metabolic pathways and stability profiles, making it a subject of interest in research focused on developing new therapeutic agents.

Formula: C₆H₁₂FNO

InChI: InChI=1S/C6H12FNO/c7-6(5-9)1-3-8-4-2-6/h8-9H,1-5H2

InChI key: InChIKey=HMCPBCNFXXRANL-UHFFFAOYSA-N

SMILES: C(O)C1(F)CCNCC1

Synonyms:

• (4-Fluoropiperidin-4-yl)methanol
• 4-Fluoro-4-piperidinemethanol
• 4-Piperidinemethanol, 4-fluoro-
• 4-Fluoro-4-(hydroxymethyl)piperidine

(4-Fluoropiperidin-4-yl)methanol

CAS: 949100-11-2

Formula: C₆H₁₂FNO

Molecular weight: 133.1640

Ref: IN-DA00IIN9