
CAS 949100-12-3
:4-(Ethoxymethyl)-4-fluoropiperidine
Description:
4-(Ethoxymethyl)-4-fluoropiperidine is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. The presence of a fluorine atom at the 4-position of the piperidine ring contributes to its unique reactivity and potential biological activity. The ethoxymethyl group, also located at the 4-position, enhances the compound's lipophilicity, which can influence its pharmacokinetic properties, such as absorption and distribution in biological systems. This compound may exhibit interesting interactions with biological targets, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for various synthetic modifications, which can lead to derivatives with altered properties. As with many fluorinated compounds, it may also exhibit enhanced metabolic stability. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Overall, 4-(Ethoxymethyl)-4-fluoropiperidine represents a class of compounds that may have applications in pharmaceuticals or agrochemicals.
Formula:C8H16FNO
InChI:InChI=1S/C8H16FNO/c1-2-11-7-8(9)3-5-10-6-4-8/h10H,2-7H2,1H3
InChI key:InChIKey=VMUKSPCISZJJEG-UHFFFAOYSA-N
SMILES:C(OCC)C1(F)CCNCC1
Synonyms:- 4-(Ethoxymethyl)-4-fluoropiperidine
- Piperidine, 4-(ethoxymethyl)-4-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.