CAS 949100-20-3
:4-(3-Ethyl-5-methyl-4H-1,2,4-triazol-4-yl)piperidine
Description:
4-(3-Ethyl-5-methyl-4H-1,2,4-triazol-4-yl)piperidine is a chemical compound characterized by its unique structure, which includes a piperidine ring and a triazole moiety. The piperidine portion contributes to its cyclic amine properties, while the triazole ring introduces heterocyclic characteristics, often associated with biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of nitrogen atoms in both the piperidine and triazole rings. Its molecular structure suggests potential applications in pharmaceuticals, particularly as a scaffold for drug development, owing to the triazole's role in enhancing biological interactions. The presence of ethyl and methyl groups can influence its lipophilicity and overall reactivity. Additionally, compounds like this may exhibit interesting pharmacological properties, including antifungal or antimicrobial activities, making them of interest in medicinal chemistry. As with any chemical substance, safety data and handling precautions should be considered when working with this compound.
Formula:C10H18N4
InChI:InChI=1S/C10H18N4/c1-3-10-13-12-8(2)14(10)9-4-6-11-7-5-9/h9,11H,3-7H2,1-2H3
InChI key:InChIKey=RQLMAUGRUFDIHN-UHFFFAOYSA-N
SMILES:C(C)C=1N(C(C)=NN1)C2CCNCC2
Synonyms:- 4-(3-Ethyl-5-methyl-4H-1,2,4-triazol-4-yl)piperidine
- Piperidine, 4-(3-ethyl-5-methyl-4H-1,2,4-triazol-4-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
