CymitQuimica logo

CAS 949100-22-5

:

4-[[(5-Ethyl-1,2,4-oxadiazol-3-yl)methoxy]methyl]piperidine

Description:
4-[[(5-Ethyl-1,2,4-oxadiazol-3-yl)methoxy]methyl]piperidine is a chemical compound characterized by its unique structure, which includes a piperidine ring and an oxadiazole moiety. The presence of the ethyl group on the oxadiazole enhances its lipophilicity, potentially influencing its biological activity and solubility. The methoxy and methyl substituents contribute to the compound's overall polarity and reactivity. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the oxadiazole ring is known for its stability and ability to participate in various chemical reactions, further expanding its utility in synthetic chemistry. Overall, this compound's characteristics, including its functional groups and structural features, position it as a potentially valuable entity in drug discovery and development.
Formula:C11H19N3O2
InChI:InChI=1S/C11H19N3O2/c1-2-11-13-10(14-16-11)8-15-7-9-3-5-12-6-4-9/h9,12H,2-8H2,1H3
InChI key:InChIKey=BJKJWCULUDBKDB-UHFFFAOYSA-N
SMILES:C(OCC1CCNCC1)C=2N=C(CC)ON2
Synonyms:
  • 4-[[(5-Ethyl-1,2,4-oxadiazol-3-yl)methoxy]methyl]piperidine
  • Piperidine, 4-[[(5-ethyl-1,2,4-oxadiazol-3-yl)methoxy]methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.