CAS 949100-33-8

2-Methyl-4-(piperidin-4-yl)pyrimidine

Description:

2-Methyl-4-(piperidin-4-yl)pyrimidine is a heterocyclic organic compound characterized by its pyrimidine ring structure, which is substituted at the 2-position with a methyl group and at the 4-position with a piperidine moiety. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar organic solvents. Its molecular structure suggests potential biological activity, particularly in medicinal chemistry, where pyrimidine derivatives are often explored for their pharmacological properties. The presence of the piperidine ring may enhance its interaction with biological targets, making it of interest in drug development. Additionally, the compound's properties, such as melting point, boiling point, and specific reactivity, can vary based on the purity and specific conditions under which it is handled. Safety data should be consulted to understand its toxicity and handling precautions, as with any chemical substance. Overall, 2-Methyl-4-(piperidin-4-yl)pyrimidine represents a versatile scaffold for further chemical modifications and potential therapeutic applications.

Formula: C₁₀H₁₅N₃

InChI: InChI=1/C10H15N3/c1-8-12-7-4-10(13-8)9-2-5-11-6-3-9/h4,7,9,11H,2-3,5-6H2,1H3

SMILES: Cc1nccc(C2CCNCC2)n1

Synonyms:

• 2-Methyl-4-(4-piperidinyl)pyrimidine
• 2-Methyl-4-(4-Piperidyl)Pyrimidine
• 2-methyl-4-piperidin-4-ylpyrimidine dihydrochloride
• 2-Methyl-4-(piperidin-4-yl)pyrimidine
• PyriMidine, 2-Methyl-4-(4-piperidinyl)-

2-Methyl-4-(piperidin-4-yl)pyrimidine

CAS: 949100-33-8

Formula: C₁₀H₁₅N₃

Molecular weight: 177.2462

Ref: IN-DA006QVT