
CAS 949161-10-8
:2,5-Dimethyl-N-[3-(trifluoromethyl)phenyl]benzenamine
Description:
2,5-Dimethyl-N-[3-(trifluoromethyl)phenyl]benzenamine, identified by its CAS number 949161-10-8, is an organic compound characterized by its complex structure, which includes a benzene ring substituted with both a dimethyl group and a trifluoromethyl group. This compound features an amine functional group, which contributes to its reactivity and potential applications in various chemical processes. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The dimethyl substitution on the benzene ring can affect the compound's steric and electronic properties, potentially impacting its interactions with other molecules. Additionally, the compound's stability, solubility, and melting or boiling points would be influenced by these substituents. Overall, 2,5-Dimethyl-N-[3-(trifluoromethyl)phenyl]benzenamine is a compound of interest in organic synthesis and medicinal chemistry, with potential applications in developing new materials or therapeutic agents.
Formula:C15H14F3N
InChI:InChI=1S/C15H14F3N/c1-10-6-7-11(2)14(8-10)19-13-5-3-4-12(9-13)15(16,17)18/h3-9,19H,1-2H3
InChI key:InChIKey=SWUBPLNGYDBIAV-UHFFFAOYSA-N
SMILES:N(C1=CC(C(F)(F)F)=CC=C1)C2=C(C)C=CC(C)=C2
Synonyms:- Benzenamine, 2,5-dimethyl-N-[3-(trifluoromethyl)phenyl]-
- 2,5-Dimethyl-N-[3-(trifluoromethyl)phenyl]benzenamine
- 2,5-Dimethyl-N-[3-(trifluoromethyl)phenyl]aniline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
