CymitQuimica logo

CAS 949161-11-9

:

2,6-Dimethyl-N-[3-(trifluoromethyl)phenyl]benzenamine

Description:
2,6-Dimethyl-N-[3-(trifluoromethyl)phenyl]benzenamine, with the CAS number 949161-11-9, is an organic compound characterized by its complex aromatic structure. It features a central aniline moiety substituted with two methyl groups at the 2 and 6 positions of the benzene ring, enhancing its hydrophobic properties. Additionally, it contains a trifluoromethyl group attached to a phenyl ring at the N-phenyl position, which significantly influences its electronic properties and reactivity due to the strong electron-withdrawing nature of the trifluoromethyl group. This compound is likely to exhibit moderate to high lipophilicity, making it soluble in organic solvents while being less soluble in water. Its unique structure may confer interesting biological activities, potentially making it a candidate for pharmaceutical applications. Furthermore, the presence of multiple functional groups suggests that it could participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Overall, 2,6-Dimethyl-N-[3-(trifluoromethyl)phenyl]benzenamine is a compound of interest in both synthetic chemistry and medicinal chemistry research.
Formula:C15H14F3N
InChI:InChI=1S/C15H14F3N/c1-10-5-3-6-11(2)14(10)19-13-8-4-7-12(9-13)15(16,17)18/h3-9,19H,1-2H3
InChI key:InChIKey=KUSPXCQKHYOKES-UHFFFAOYSA-N
SMILES:N(C1=CC(C(F)(F)F)=CC=C1)C2=C(C)C=CC=C2C
Synonyms:
  • Benzenamine, 2,6-dimethyl-N-[3-(trifluoromethyl)phenyl]-
  • 2,6-Dimethyl-N-[3-(trifluoromethyl)phenyl]benzenamine
  • 2,6-Dimethyl-N-(3-(trifluoromethyl)phenyl)aniline
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.