CAS 949459-75-0

(2S,3S)-3-amino-2-hydroxy-3-phenyl-propanoic acid hydrochloride

Description:

(2S,3S)-3-amino-2-hydroxy-3-phenyl-propanoic acid hydrochloride, also known as a derivative of phenylalanine, is an amino acid characterized by its chiral centers at the second and third carbon atoms. This compound features an amino group (-NH2), a hydroxyl group (-OH), and a phenyl group attached to a propanoic acid backbone, contributing to its biological activity and potential applications in pharmaceuticals. The hydrochloride form indicates that it is a salt, enhancing its solubility in water, which is beneficial for various biochemical applications. The specific stereochemistry (2S,3S) is crucial for its interaction with biological systems, as the configuration can influence its binding to receptors and enzymes. This compound may exhibit properties such as being a potential neurotransmitter or a precursor in metabolic pathways. Its unique structure allows for various interactions in biological systems, making it of interest in medicinal chemistry and drug design. As with many amino acids, it may also play a role in protein synthesis and cellular functions.

Formula: C₉H₁₂ClNO₃

InChI: InChI=1/C9H11NO3.ClH/c10-7(8(11)9(12)13)6-4-2-1-3-5-6;/h1-5,7-8,11H,10H2,(H,12,13);1H/t7-,8-;/m0./s1

SMILES: c1ccc(cc1)[C@@H]([C@@H](C(=O)O)O)N.Cl

Synonyms:

• (2S,3S)-3-Phenylisoserin hydrochloride

(alphaS,betaS)-β-Phenyl Isoserine Hydrochloride

Controlled Product

CAS: 949459-75-0

Formula: C₉H₁₁NO₃·HCl

Color and Shape: Neat

Molecular weight: 217.649

Ref: TR-P335435