CymitQuimica logo

CAS 949459-76-1

:

(4S,5S)-3-Benzoyl-2-(4-methoxyphenyl)-4-phenyl-5-oxazolidinecarboxylic acid

Description:
The chemical substance known as (4S,5S)-3-Benzoyl-2-(4-methoxyphenyl)-4-phenyl-5-oxazolidinecarboxylic acid, with the CAS number 949459-76-1, is characterized by its oxazolidine structure, which incorporates a carboxylic acid functional group. This compound features a chiral center, indicated by the (4S,5S) configuration, suggesting it exists as a specific stereoisomer. The presence of the benzoyl and 4-methoxyphenyl groups contributes to its potential as a pharmaceutical intermediate or active ingredient, likely influencing its biological activity and solubility. The oxazolidine ring provides a unique framework that may exhibit specific reactivity patterns, making it of interest in synthetic organic chemistry. Additionally, the compound's molecular interactions could be significant in drug design, particularly in targeting specific biological pathways. Its stability, solubility, and reactivity would depend on various factors, including pH and temperature, which are critical for applications in medicinal chemistry and material science.
Formula:C24H21NO5
InChI:InChI=1S/C24H21NO5/c1-29-19-14-12-18(13-15-19)23-25(22(26)17-10-6-3-7-11-17)20(21(30-23)24(27)28)16-8-4-2-5-9-16/h2-15,20-21,23H,1H3,(H,27,28)/t20-,21-,23?/m0/s1
InChI key:InChIKey=RDVJYGYJBUIIOE-MMBKUXRPSA-N
SMILES:C(=O)(N1[C@H]([C@@H](C(O)=O)OC1C2=CC=C(OC)C=C2)C3=CC=CC=C3)C4=CC=CC=C4
Synonyms:
  • (4S,5S)-3-Benzoyl-2-(4-methoxyphenyl)-4-phenyl-5-oxazolidinecarboxylic acid
  • 5-Oxazolidinecarboxylic acid, 3-benzoyl-2-(4-methoxyphenyl)-4-phenyl-, (4S,5S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.