CAS 94952-46-2

1-(5-chloropyridin-2-yl)ethanone

Description:

1-(5-Chloropyridin-2-yl)ethanone, with the CAS number 94952-46-2, is an organic compound characterized by its pyridine ring substituted with a chlorine atom and an ethanone functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It possesses a molecular formula that reflects its structure, indicating the presence of carbon, hydrogen, nitrogen, and chlorine atoms. The compound is known for its potential applications in medicinal chemistry and as an intermediate in the synthesis of various pharmaceuticals. Its reactivity is influenced by the electron-withdrawing nature of the chlorine atom, which can affect nucleophilic attack at the carbonyl carbon. Additionally, 1-(5-chloropyridin-2-yl)ethanone may exhibit specific physical properties such as boiling and melting points, solubility in organic solvents, and stability under standard laboratory conditions. Safety data should be consulted to understand its handling and potential hazards, as with any chemical substance.

Formula: C₇H₆ClNO

InChI: InChI=1/C7H6ClNO/c1-5(10)7-3-2-6(8)4-9-7/h2-4H,1H3

SMILES: CC(=O)c1ccc(cn1)Cl

Synonyms:

• 2-Acetyl-5-chloropyridine

1-(5-Chloropyridin-2-yl)ethanone

CAS: 94952-46-2

Formula: C₇H₆ClNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 155.5816

Ref: IN-DA006QS7

2-Acetyl-5-chloropyridine

CAS: 94952-46-2

2-Acetyl-5-chloropyridine

Purity: 98%

Molecular weight: 155.58g/mol

Ref: 54-OR345463

2-Acetyl-5-chloropyridine

CAS: 94952-46-2

Purity: 98%

Molecular weight: 155.582

Ref: FT-Y14233

1-(5-Chloropyridin-2-yl)ethanone

CAS: 94952-46-2

Formula: C₇H₆ClNO

Purity: 95%

Color and Shape: Solid

Molecular weight: 155.58

Ref: 10-F209177