CymitQuimica logo

CAS 949556-53-0

:

4-(2-Fluoro-4-nitrophenoxy)-1H-pyrazolo[3,4-b]pyridine

Description:
4-(2-Fluoro-4-nitrophenoxy)-1H-pyrazolo[3,4-b]pyridine is a chemical compound characterized by its complex structure, which includes a pyrazolo[3,4-b]pyridine core fused with a phenoxy group that carries a fluoro and nitro substituent. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its unique functional groups. The presence of the nitro group may impart polar characteristics, while the fluorine atom can enhance lipophilicity and influence the compound's reactivity. Such compounds are often studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The molecular structure suggests that it may participate in hydrogen bonding and other intermolecular interactions, which can affect its solubility and stability. Overall, 4-(2-Fluoro-4-nitrophenoxy)-1H-pyrazolo[3,4-b]pyridine represents a class of compounds that may have significant implications in drug discovery and development.
Formula:C12H7FN4O3
InChI:InChI=1S/C12H7FN4O3/c13-9-5-7(17(18)19)1-2-11(9)20-10-3-4-14-12-8(10)6-15-16-12/h1-6H,(H,14,15,16)
InChI key:InChIKey=HTBGLQKTBYVJNQ-UHFFFAOYSA-N
SMILES:O(C1=C2C(NN=C2)=NC=C1)C3=C(F)C=C(N(=O)=O)C=C3
Synonyms:
  • 1H-Pyrazolo[3,4-b]pyridine, 4-(2-fluoro-4-nitrophenoxy)-
  • 4-(2-Fluoro-4-nitrophenoxy)-1H-pyrazolo[3,4-b]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.