CAS 94971-19-4

5-morpholin-4-yl-4-phenyl-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

5-Morpholin-4-yl-4-phenyl-2,4-dihydro-3H-1,2,4-triazole-3-thione, with CAS number 94971-19-4, is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance features a morpholine group, which is a six-membered ring containing both oxygen and nitrogen, contributing to its potential biological activity. The presence of a phenyl group enhances its lipophilicity and may influence its interaction with biological targets. As a thione, it contains a sulfur atom double-bonded to a carbon atom, which can impart unique reactivity and stability properties. This compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Overall, the structural features of this compound suggest potential applications in drug development and other chemical research areas.

Formula: C₁₂H₁₄N₄OS

InChI: InChI=1/C12H14N4OS/c18-12-14-13-11(15-6-8-17-9-7-15)16(12)10-4-2-1-3-5-10/h1-5H,6-9H2,(H,14,18)

SMILES: c1ccc(cc1)n1c(nnc1S)N1CCOCC1

Synonyms:

• 5-morpholin-4-yl-4-phenyl-4H-1,2,4-triazole-3-thiol

5-Morpholino-4-phenyl-4H-1,2,4-triazole-3-thiol

CAS: 94971-19-4

Formula: C₁₂H₁₄N₄OS

Molecular weight: 262.3308

Ref: IN-DA0066WF

5-(Morpholin-4-yl)-4-phenyl-4H-1,2,4-triazole-3-thiol

CAS: 94971-19-4

Versatile small molecule scaffold

Formula: C₁₂H₁₄N₄OS

Purity: Min. 95%

Molecular weight: 262.33 g/mol

Ref: 3D-UDA97119