
CAS 94978-16-2
:(3aR,5S,6aR,7S,9aS,9bS,11aR)-5-(3-Furanyl)hexahydro-7,9b,11a-trimethyl-5,9a-epoxy-3H,9aH-furo[3,4-f]pyrano[4,3,2-de][1]benzopyran-1,8(7H,10H)-dione
Description:
The chemical substance with the name "(3aR,5S,6aR,7S,9aS,9bS,11aR)-5-(3-Furanyl)hexahydro-7,9b,11a-trimethyl-5,9a-epoxy-3H,9aH-furo[3,4-f]pyrano[4,3,2-de][1]benzopyran-1,8(7H,10H)-dione" and CAS number 94978-16-2 is a complex organic compound characterized by its intricate polycyclic structure, which includes multiple fused rings and functional groups. This compound features a furan moiety, contributing to its aromatic properties, and exhibits a range of stereocenters that define its three-dimensional conformation. The presence of epoxy groups suggests potential reactivity, particularly in nucleophilic addition reactions. Its dione functionality indicates the presence of two carbonyl groups, which can participate in various chemical transformations. The specific stereochemistry and functional groups may influence its biological activity, making it of interest in medicinal chemistry and natural product synthesis. Overall, this compound exemplifies the complexity and diversity of organic molecules, with potential applications in pharmaceuticals or as a synthetic intermediate in organic synthesis.
Formula:C20H22O7
InChI:InChI=1S/C20H22O7/c1-11-13-8-18(12-4-7-23-9-12)26-19-10-24-15(22)16(19,2)5-6-20(27-18,17(13,19)3)25-14(11)21/h4,7,9,11,13H,5-6,8,10H2,1-3H3/t11-,13+,16-,17-,18-,19-,20+/m0/s1
InChI key:InChIKey=MIZCOUBLUGPQEO-TWLIFTOHSA-N
SMILES:C[C@]12[C@]34[C@@](C)(CC[C@@]15O[C@@](O3)(C[C@@]2([C@H](C)C(=O)O5)[H])C=6C=COC6)C(=O)OC4
Synonyms:- 5,9a-Epoxy-3H,9aH-furo[3,4-f]pyrano[4,3,2-de][1]benzopyran-1,8(7H,10H)-dione, 5-(3-furanyl)hexahydro-7,9b,11a-trimethyl-, (3aR,5S,6aR,7S,9aS,9bS,11aR)-
- Saudin
- (-)-Saudin
- (3aR,5S,6aR,7S,9aS,9bS,11aR)-5-(3-Furanyl)hexahydro-7,9b,11a-trimethyl-5,9a-epoxy-3H,9aH-furo[3,4-f]pyrano[4,3,2-de][1]benzopyran-1,8(7H,10H)-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Saudin
CAS:Saudin is a naturally occurring hypoglycemic diterpene.Formula:C20H22O7Color and Shape:SolidMolecular weight:374.38
