CAS 94991-72-7
:(2S)-1-(2,6-dimethylphenoxy)propan-2-amine
Description:
(2S)-1-(2,6-dimethylphenoxy)propan-2-amine, with the CAS number 94991-72-7, is a chiral amine characterized by its specific stereochemistry at the second carbon of the propanamine backbone. This compound features a propan-2-amine structure, which includes an amine functional group (-NH2) and a phenoxy group derived from 2,6-dimethylphenol. The presence of the dimethyl groups on the aromatic ring contributes to its hydrophobic character, potentially influencing its solubility and interaction with biological systems. As a chiral molecule, it may exhibit different biological activities depending on its stereochemistry, which is crucial in pharmaceutical applications. The compound's properties, such as melting point, boiling point, and solubility, are influenced by its molecular structure and functional groups. Additionally, it may serve as a precursor or intermediate in the synthesis of various pharmaceuticals or agrochemicals, highlighting its relevance in organic synthesis and medicinal chemistry.
Formula:C11H17NO
InChI:InChI=1/C11H17NO/c1-8-5-4-6-9(2)11(8)13-7-10(3)12/h4-6,10H,7,12H2,1-3H3/t10-/m0/s1
SMILES:Cc1cccc(C)c1OC[C@H](C)N
Synonyms:- 2-propanamine, 1-(2,6-dimethylphenoxy)-, (2S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
