CAS 949922-29-6

1,2,3,4-Tetrahydro-N-methyl-7-isoquinolinecarboxamide

Description:

1,2,3,4-Tetrahydro-N-methyl-7-isoquinolinecarboxamide is a chemical compound characterized by its isoquinoline structure, which is a bicyclic compound featuring a fused benzene and pyridine ring. This substance is a derivative of isoquinoline, specifically modified with a tetrahydro group and a methyl amide functional group. The presence of the tetrahydro moiety indicates that the compound has undergone partial hydrogenation, resulting in a saturated ring structure that can influence its reactivity and biological activity. The N-methyl group suggests that the nitrogen atom in the amide is substituted with a methyl group, which can affect the compound's solubility and interaction with biological targets. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of drugs targeting neurological or psychiatric conditions. Its specific characteristics, such as melting point, solubility, and spectral data, would typically be determined through experimental methods and are essential for understanding its behavior in various applications.

Formula: C₁₁H₁₄N₂O

InChI: InChI=1S/C11H14N2O/c1-12-11(14)9-3-2-8-4-5-13-7-10(8)6-9/h2-3,6,13H,4-5,7H2,1H3,(H,12,14)

InChI key: InChIKey=IGKIDZOQXSVERB-UHFFFAOYSA-N

SMILES: C(NC)(=O)C=1C=C2C(=CC1)CCNC2

Synonyms:

• 7-Isoquinolinecarboxamide, 1,2,3,4-tetrahydro-N-methyl-
• 1,2,3,4-Tetrahydro-N-methyl-7-isoquinolinecarboxamide