CAS 949922-49-0
:ethyl 2-chloro-7,8-dihydro-5H-pyrido[3,4-b]pyrazine-6-carboxylate
Description:
Ethyl 2-chloro-7,8-dihydro-5H-pyrido[3,4-b]pyrazine-6-carboxylate is a chemical compound characterized by its complex bicyclic structure, which incorporates both pyridine and pyrazine moieties. This compound features a carboxylate ester functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of a chlorine atom at the 2-position enhances its electrophilic character, making it suitable for further chemical modifications. Ethyl 2-chloro-7,8-dihydro-5H-pyrido[3,4-b]pyrazine-6-carboxylate is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique structure suggests potential biological activity, which could be explored in medicinal chemistry. The compound's CAS number, 949922-49-0, allows for easy identification and retrieval of information in chemical databases. Overall, this substance represents a valuable scaffold for the development of novel compounds in various fields, including pharmaceuticals and agrochemicals.
Formula:C10H12ClN3O2
InChI:InChI=1/C10H12ClN3O2/c1-2-16-10(15)14-4-3-7-8(6-14)12-5-9(11)13-7/h5H,2-4,6H2,1H3
SMILES:CCOC(=O)N1CCc2c(C1)ncc(Cl)n2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ethyl 2-chloro-7,8-dihydropyrido[3,4-b]pyrazine-6(5H)-carboxylate
CAS:Formula:C10H12ClN3O2Molecular weight:241.6742
