CymitQuimica logo

CAS 94994-15-7

:

methyl 1-(hydroxymethyl)bicyclo[2.2.2]octane-4-carboxylate

Description:
Methyl 1-(hydroxymethyl)bicyclo[2.2.2]octane-4-carboxylate, with the CAS number 94994-15-7, is a bicyclic organic compound characterized by its unique bicyclo[2.2.2]octane structure, which consists of a fused ring system. This compound features a carboxylate functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of a hydroxymethyl group enhances its polarity and solubility in polar solvents, making it suitable for various chemical reactions. Methyl esters, like this compound, are often used in the synthesis of pharmaceuticals and agrochemicals due to their ability to undergo hydrolysis and transesterification. The bicyclic framework provides rigidity, which can influence the compound's biological activity and interaction with other molecules. Overall, methyl 1-(hydroxymethyl)bicyclo[2.2.2]octane-4-carboxylate is a versatile compound with potential applications in medicinal chemistry and materials science, although specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C11H18O3
InChI:InChI=1/C11H18O3/c1-14-9(13)11-5-2-10(8-12,3-6-11)4-7-11/h12H,2-8H2,1H3
InChI key:CNDFZCWNUACFHZ-UHFFFAOYSA-N
SMILES:COC(=O)C12CCC(CC1)(CC2)CO
Synonyms:
  • Methyl 4-(Hydroxymethyl)Bicyclo[2.2.2]Octane-1-Carboxylate
Found 5 products.