CymitQuimica logo

CAS 94994-39-5

:

Butanoic acid, 4-[[(1,1-dimethylethoxy)carbonyl]methylamino]-

Description:
Butanoic acid, 4-[[(1,1-dimethylethoxy)carbonyl]methylamino]- is a chemical compound characterized by its carboxylic acid functional group, which imparts acidic properties. The presence of the butanoic acid moiety suggests it has a four-carbon straight-chain structure, contributing to its hydrophobic characteristics. The compound also features a dimethylethoxycarbonyl group, indicating the presence of an ether and a carbonyl functional group, which can influence its reactivity and solubility in organic solvents. The methylamino group suggests potential for hydrogen bonding and interactions with other polar molecules. This compound may exhibit biological activity due to its structural features, making it of interest in pharmaceutical and chemical research. Its CAS number, 94994-39-5, allows for precise identification in chemical databases. Overall, the combination of these functional groups suggests that this compound could participate in various chemical reactions, including esterification and amidation, and may have applications in synthetic organic chemistry or medicinal chemistry.
Formula:C10H19NO4
InChI:InChI=1S/C10H19NO4/c1-10(2,3)15-9(14)11(4)7-5-6-8(12)13/h5-7H2,1-4H3,(H,12,13)
InChI key:PXAKQDWAISFHCM-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N(C)CCCC(=O)O
Found 5 products.