CymitQuimica logo

CAS 950037-24-8

:

2-chloro-4,7,8-trimethyl-quinoline

Description:
2-Chloro-4,7,8-trimethyl-quinoline is a synthetic organic compound belonging to the quinoline family, characterized by a bicyclic structure that includes a benzene ring fused to a pyridine ring. This compound features a chlorine atom and three methyl groups attached to the quinoline framework, which can influence its chemical reactivity and physical properties. Typically, quinolines exhibit properties such as moderate solubility in organic solvents and potential biological activity, making them of interest in medicinal chemistry. The presence of the chlorine substituent can enhance lipophilicity and alter the compound's interaction with biological targets. Additionally, the methyl groups can affect the steric hindrance and electronic distribution within the molecule, potentially impacting its reactivity and stability. As with many quinoline derivatives, 2-chloro-4,7,8-trimethyl-quinoline may exhibit fluorescence and could be utilized in various applications, including as a dye or in the development of pharmaceuticals. However, specific safety and handling information should be consulted from reliable sources due to the potential toxicity associated with chlorine-containing compounds.
Formula:C12H12ClN
InChI:InChI=1/C12H12ClN/c1-7-4-5-10-8(2)6-11(13)14-12(10)9(7)3/h4-6H,1-3H3
InChI key:OSCHOKMWJQRQQL-UHFFFAOYSA-N
SMILES:CC1=C(C2=C(C=C1)C(=CC(=N2)Cl)C)C
Synonyms:
  • 2-Chloro-4,7,8-Trimethylquinoline
  • Quinoline, 2-Chloro-4,7,8-Trimethyl-
Found 3 products.