
CAS 95014-75-8
:Phytochelatin 2
Description:
Phytochelatin 2 is a type of phytochelatin, which is a class of peptides synthesized by plants in response to heavy metal stress, particularly cadmium, lead, and other toxic metals. The structure of phytochelatins consists of repeating units of gamma-glutamylcysteine linked to a terminal glycine. Phytochelatin 2 specifically contains two units of gamma-glutamylcysteine and one glycine, making it a tripeptide. This compound plays a crucial role in the detoxification of heavy metals by binding to them, thereby facilitating their sequestration and reducing their bioavailability and toxicity within plant tissues. Phytochelatin 2 is characterized by its ability to form stable complexes with metal ions, which is essential for plant survival in contaminated environments. Additionally, phytochelatins are known for their antioxidant properties, contributing to the overall stress response in plants. The CAS number 95014-75-8 uniquely identifies this specific phytochelatin, aiding in its recognition and study in various scientific and agricultural contexts.
Formula:C18H29N5O10S2
InChI:InChI=1S/C18H29N5O10S2/c19-8(17(30)31)1-3-12(24)22-11(7-35)16(29)23-9(18(32)33)2-4-13(25)21-10(6-34)15(28)20-5-14(26)27/h8-11,34-35H,1-7,19H2,(H,20,28)(H,21,25)(H,22,24)(H,23,29)(H,26,27)(H,30,31)(H,32,33)/t8-,9-,10-,11-/m0/s1
InChI key:InChIKey=CGZITCMVSSNQPE-NAKRPEOUSA-N
SMILES:[C@H](C(N[C@@H](CCC(N[C@H](C(NCC(O)=O)=O)CS)=O)C(O)=O)=O)(NC(CC[C@@H](C(O)=O)N)=O)CS
Synonyms:- 3-7-Cadystin A (reduced)
- Phytochelatin 2
- Glycine, L-γ-glutamyl-L-cysteinyl-L-γ-glutamyl-L-cysteinyl-
- L-γ-Glutamyl-L-cysteinyl-L-γ-glutamyl-L-cysteinylglycine
- Cadystin B (reduced)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Phytochelatin 2 (PC2)
CAS:Custom research peptide; min purity 95%. For different specs please use the Peptide Quote ToolFormula:C18H29N5O10S2Molecular weight:539.58 g/mol
