CymitQuimica logo

CAS 950255-92-2

:

1-(4-BROMOBENZYLSULFONYL)PYRROLIDINE

Description:
1-(4-Bromobenzylsulfonyl)pyrrolidine is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a sulfonyl group attached to a 4-bromobenzyl moiety. This compound typically exhibits properties associated with both the pyrrolidine and sulfonyl functional groups, such as potential solubility in polar solvents and the ability to participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions. The presence of the bromine atom may enhance its reactivity and influence its biological activity, making it of interest in medicinal chemistry and drug development. Additionally, the sulfonyl group can contribute to the compound's stability and reactivity profile. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, can vary based on environmental conditions and the presence of other substances. Safety data should be consulted for handling and usage, as compounds with halogen substituents can pose specific health risks.
Formula:C11H14BrNO2S
InChI:InChI=1/C11H14BrNO2S/c12-11-5-3-10(4-6-11)9-16(14,15)13-7-1-2-8-13/h3-6H,1-2,7-9H2
SMILES:C1CCN(C1)S(=O)(=O)Cc1ccc(cc1)Br
Synonyms:
  • 1-[(4-Bromophenyl)Methylsulfonyl]Pyrrolidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.