CymitQuimica logo

CAS 950596-58-4

:

2-Amino-4,5-bis(2-methoxyethoxy)benzonitrile

Description:
2-Amino-4,5-bis(2-methoxyethoxy)benzonitrile, identified by its CAS number 950596-58-4, is an organic compound characterized by the presence of an amino group and a nitrile functional group attached to a benzene ring. The structure features two methoxyethoxy substituents, which enhance its solubility and may influence its reactivity and interaction with biological systems. This compound is likely to exhibit moderate polarity due to the presence of ether linkages and the amino group, which can participate in hydrogen bonding. Its nitrile group contributes to its potential as a versatile building block in organic synthesis and medicinal chemistry. The compound may also possess interesting pharmacological properties, making it a candidate for further research in drug development. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Overall, 2-Amino-4,5-bis(2-methoxyethoxy)benzonitrile represents a complex organic molecule with potential applications in various fields of chemistry and biochemistry.
Formula:C13H18N2O4
InChI:InChI=1S/C13H18N2O4/c1-16-3-5-18-12-7-10(9-14)11(15)8-13(12)19-6-4-17-2/h7-8H,3-6,15H2,1-2H3
InChI key:XCXKYIJVCWFCLF-UHFFFAOYSA-N
SMILES:COCCOC1=C(C=C(C(=C1)C#N)N)OCCOC
Synonyms:
  • Erlotinib intermediate
  • Ethyl 2-Amino-4,5-Bis(2-Methoxyethoxy)-2-Aminobenzoate
  • 4-5-Bis(2-Methoxyethoxy)-2-Aminobenzonitrile
Found 7 products.