CymitQuimica logo

CAS 950644-35-6

:

3-(3,4-Difluorophenoxy)-1-propanamine

Description:
3-(3,4-Difluorophenoxy)-1-propanamine is an organic compound characterized by its unique structure, which includes a propanamine backbone and a phenoxy group substituted with two fluorine atoms at the 3 and 4 positions of the aromatic ring. This compound typically exhibits properties associated with both amines and aromatic compounds, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the amine functional group. The presence of fluorine atoms can enhance lipophilicity and influence the compound's reactivity and biological activity. Additionally, the compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. However, detailed information regarding its toxicity, stability, and specific applications would require further investigation through experimental studies and literature review.
Formula:C9H11F2NO
InChI:InChI=1S/C9H11F2NO/c10-8-3-2-7(6-9(8)11)13-5-1-4-12/h2-3,6H,1,4-5,12H2
InChI key:InChIKey=AWYGOLUQNKJPPU-UHFFFAOYSA-N
SMILES:O(CCCN)C1=CC(F)=C(F)C=C1
Synonyms:
  • 1-Propanamine, 3-(3,4-difluorophenoxy)-
  • 3-(3,4-Difluorophenoxy)-1-propanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.