CAS 950687-46-4

6-Fluoro-α-(trifluoromethyl)-3-pyridinemethanol

Description:

6-Fluoro-α-(trifluoromethyl)-3-pyridinemethanol is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a fluorine atom at the 6-position and a trifluoromethyl group at the α-position contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. The hydroxymethyl group (-CH2OH) at the 3-position enhances its reactivity and solubility in polar solvents. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the trifluoromethyl group is known to influence the compound's metabolic stability and bioavailability. As with many fluorinated compounds, it may also exhibit distinct interactions with biological targets due to the electronegative nature of fluorine. Overall, 6-Fluoro-α-(trifluoromethyl)-3-pyridinemethanol represents a valuable compound for further research in various chemical and pharmaceutical applications.

Formula: C₇H₅F₄NO

InChI: InChI=1S/C7H5F4NO/c8-5-2-1-4(3-12-5)6(13)7(9,10)11/h1-3,6,13H

InChI key: InChIKey=CQUSMANDIRLIEM-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)(O)C=1C=CC(F)=NC1

Synonyms:

• 3-Pyridinemethanol, 6-fluoro-α-(trifluoromethyl)-
• 2,2,2-Trifluoro-1-(6-fluoropyridin-3-yl)ethan-1-ol
• 2,2,2-Trifluoro-1-(6-fluoropyridin-3-yl)ethanol
• 6-Fluoro-α-(trifluoromethyl)-3-pyridinemethanol