CAS 950691-52-8

6-chloro-5-fluoropyridine-3-carbaldehyde

Description:

6-Chloro-5-fluoropyridine-3-carbaldehyde is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chloro group at the 6-position and a fluorine atom at the 5-position contributes to its unique reactivity and properties. The aldehyde functional group at the 3-position is indicative of its potential as a reactive intermediate in various chemical reactions, particularly in synthesis. This compound is typically a pale yellow to light brown liquid or solid, depending on its purity and form. It is soluble in organic solvents, making it useful in organic synthesis and medicinal chemistry. The presence of halogen substituents often enhances the compound's biological activity, making it of interest in pharmaceutical research. Additionally, its structure allows for potential applications in agrochemicals and materials science. Safety precautions should be taken when handling this compound, as it may pose health risks due to its reactive functional groups and halogen content.

Formula: C₆H₃ClFNO

InChI: InChI=1/C6H3ClFNO/c7-6-5(8)1-4(3-10)2-9-6/h1-3H

SMILES: c1c(cnc(c1F)Cl)C=O

Synonyms:

• 3-Pyridinecarboxaldehyde, 6-Chloro-5-Fluoro-
• 6-Chloro-5-fluoronicotinaldehyde
• 6-Chloro-3-fluoronicotinaldehyde

6-Chloro-5-fluoronicotinaldehyde

CAS: 950691-52-8

Formula: C₆H₃ClFNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 159.5455

Ref: IN-DA0066IJ

6-Chloro-5-fluoropyridine-3-carbaldehyde

CAS: 950691-52-8

6-Chloro-5-fluoropyridine-3-carbaldehyde

Purity: 97%

Molecular weight: 159.55g/mol

Ref: 54-PC900606

6-Chloro-5-fluoronicotinaldehyde

CAS: 950691-52-8

Formula: C₆H₃ClFNO

Purity: 97%

Color and Shape: Solid

Molecular weight: 159.54

Ref: 10-F234234