CAS 950746-19-7
:2H-2,7-naphthyridin-1-one hydrobromide
Description:
2H-2,7-naphthyridin-1-one hydrobromide is a chemical compound characterized by its heterocyclic structure, which includes a naphthyridine moiety. This compound features a nitrogen-containing ring system, specifically a 2H-naphthyridine, which contributes to its potential biological activity. The presence of the hydrobromide salt form indicates that it is a protonated version of the base compound, enhancing its solubility in polar solvents, which is often advantageous for pharmaceutical applications. The compound may exhibit various properties such as fluorescence, depending on its specific electronic structure, and it may participate in hydrogen bonding due to the presence of nitrogen atoms. Its potential applications could span medicinal chemistry, particularly in the development of pharmaceuticals, given the significance of naphthyridine derivatives in drug discovery. However, specific biological activities, toxicity, and stability would require further investigation through empirical studies. As with any chemical substance, proper handling and safety protocols should be observed, especially when dealing with hydrobromide salts.
Formula:C8H7BrN2O
InChI:InChI=1/C8H6N2O.BrH/c11-8-7-5-9-3-1-6(7)2-4-10-8;/h1-5H,(H,10,11);1H
Synonyms:- 2,7-naphthyridin-1(2H)-one, hydrobromide (1:1)
- 2,7-Naphthyridin-1(2H)-one hydrobromide (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
