CymitQuimica logo

CAS 95093-94-0

:

acetic acid; heptanamidine

Description:
Acetic acid, heptanamidine, identified by the CAS number 95093-94-0, is a chemical compound that combines the functional groups of acetic acid and heptanamidine. Acetic acid is a simple carboxylic acid known for its pungent smell and is commonly used in food preservation and as a chemical reagent. Heptanamidine, on the other hand, is an amine derivative that may exhibit properties typical of primary amines, such as basicity and the ability to form salts with acids. The combination of these two components suggests that the compound may possess both acidic and basic characteristics, potentially leading to interesting reactivity and solubility profiles in various solvents. The presence of both an amine and a carboxylic acid group may allow for the formation of zwitterionic species under certain conditions. This compound could have applications in organic synthesis, pharmaceuticals, or as a biochemical reagent, although specific applications would depend on its detailed chemical behavior and stability. Further studies would be necessary to fully elucidate its properties and potential uses.
Formula:C9H20N2O2
InChI:InChI=1/C7H16N2.C2H4O2/c1-2-3-4-5-6-7(8)9;1-2(3)4/h2-6H2,1H3,(H3,8,9);1H3,(H,3,4)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.