CAS 95094-87-4
:5-hydroxy-1-benzothiophene-2-carboxylic acid
Description:
5-Hydroxy-1-benzothiophene-2-carboxylic acid, identified by its CAS number 95094-87-4, is a chemical compound that features a benzothiophene core, which is a bicyclic structure consisting of a benzene ring fused to a thiophene ring. This compound is characterized by the presence of a hydroxyl group (-OH) at the 5-position and a carboxylic acid group (-COOH) at the 2-position of the benzothiophene structure. These functional groups contribute to its polar nature, enhancing its solubility in polar solvents. The hydroxyl group can participate in hydrogen bonding, which may influence its reactivity and interactions with other molecules. Additionally, the carboxylic acid group can act as a weak acid, capable of donating protons in solution. The compound may exhibit biological activity, making it of interest in medicinal chemistry and research. Its unique structure and functional groups suggest potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis.
Formula:C9H6O3S
InChI:InChI=1/C9H6O3S/c10-6-1-2-7-5(3-6)4-8(13-7)9(11)12/h1-4,10H,(H,11,12)
SMILES:c1cc2c(cc1O)cc(C(=O)O)s2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.