CAS 95104-21-5

2-chloroquinoline-3-carbonitrile

Description:

2-Chloroquinoline-3-carbonitrile is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a chlorine atom at the second position and a cyano group (-C≡N) at the third position of the quinoline ring contributes to its unique chemical properties. This compound typically appears as a solid and is known for its potential applications in pharmaceuticals, particularly in the development of biologically active molecules. Its structure allows for various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, making it a versatile intermediate in organic synthesis. Additionally, the presence of the cyano group enhances its reactivity and can influence its solubility and polarity. Safety data indicates that, like many halogenated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 2-chloroquinoline-3-carbonitrile is a significant compound in medicinal chemistry and materials science.

Formula: C₁₀H₅ClN₂

InChI: InChI=1/C10H5ClN2/c11-10-8(6-12)5-7-3-1-2-4-9(7)13-10/h1-5H

SMILES: c1ccc2c(c1)cc(C#N)c(Cl)n2

Synonyms:

• 2-Chloro-3-cyanoquinoline
• 3-Quinolinecarbonitrile, 2-Chloro-
• 2-Chloroquinoline-3-carbonitrile

2-Chloroquinoline-3-carbonitrile

CAS: 95104-21-5

Formula: C₁₀H₅ClN₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 188.6131

Ref: IN-DA003H3L

2-Chloroquinoline-3-carbonitrile

CAS: 95104-21-5

2-Chloroquinoline-3-carbonitrile

Purity: 95%

Molecular weight: 188.6131g/mol

Ref: 54-OR307835

2-Chloro-3-cyanoquinoline

CAS: 95104-21-5

Formula: C₁₀H₅ClN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 188.61

Ref: 10-F049091

2-Chloro-3-cyanoquinoline

CAS: 95104-21-5

2-Chloro-3-cyanoquinoline is a potent antitumor agent that has been shown to have an inhibitory effect on cancer cell growth. In the process of chemical reactions, 2-chloro-3-cyanoquinoline can be synthesized by reacting an aryl halide with amines. The compound is also a quinoline derivative, which has been used as an anticancer drug. 2-Chloro-3-cyanoquinoline inhibits cancer cell proliferation and induces apoptosis in cells without affecting normal cells. It binds to the mitochondrial membrane potential and inhibits the intracellular production of reactive oxygen species, leading to inhibition of mitosis. Furthermore, it can be used as a probe for studying nucleophilic attack on amines.

Formula: C₁₀H₅ClN₂

Purity: Min. 95%

Molecular weight: 188.61 g/mol

Ref: 3D-VDA10421