CAS 95110-10-4

2,6-Dimethoxyphenoxyacetic acid

Description:

2,6-Dimethoxyphenoxyacetic acid is an organic compound characterized by its phenoxyacetic acid structure, which includes a phenolic ring substituted with two methoxy groups at the 2 and 6 positions. This compound typically appears as a white to off-white solid and is soluble in organic solvents, while its solubility in water may vary. It is known for its potential applications in the field of herbicides and plant growth regulators, as it can influence plant growth and development. The presence of the methoxy groups enhances its lipophilicity, which can affect its biological activity and interaction with plant systems. Additionally, 2,6-Dimethoxyphenoxyacetic acid may exhibit specific reactivity due to the functional groups present, making it a subject of interest in both agricultural and pharmaceutical research. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₀H₁₂O₅

InChI: InChI=1/C10H12O5/c1-13-7-4-3-5-8(14-2)10(7)15-6-9(11)12/h3-5H,6H2,1-2H3,(H,11,12)

SMILES: COc1cccc(c1OCC(=O)O)OC

Synonyms:

• Acetic Acid, 2-(2,6-Dimethoxyphenoxy)-

2,6-Dimethoxyphenoxyacetic acid

CAS: 95110-10-4

Formula: C₁₀H₁₂O₅

Purity: 98%

Molecular weight: 212.1993

Ref: IN-DA003G57

2-(2,6-Dimethoxyphenoxy)acetic acid

CAS: 95110-10-4

2-(2,6-Dimethoxyphenoxy)acetic acid

Purity: 98%

Molecular weight: 212.2g/mol

Ref: 54-OR1062770

2-(2,6-Dimethoxyphenoxy)acetic acid

CAS: 95110-10-4

Purity: 98%

Molecular weight: 212.201004

Ref: 10-F713540