CAS 95112-14-4: 2-ethyl-2H-tetrazol-5-amine

Description:2-Ethyl-2H-tetrazol-5-amine, with the CAS number 95112-14-4, is a chemical compound that belongs to the tetrazole family, characterized by a five-membered ring containing four nitrogen atoms and one carbon atom. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in various fields, including pharmaceuticals and materials science. The presence of the ethyl group contributes to its hydrophobic characteristics, while the amine functional group can engage in hydrogen bonding, influencing its solubility and reactivity. Tetrazoles are known for their stability and can serve as precursors for the synthesis of other nitrogen-containing compounds. Additionally, 2-ethyl-2H-tetrazol-5-amine may exhibit biological activity, making it of interest in medicinal chemistry. Its unique structure allows for diverse chemical modifications, which can enhance its properties for specific applications. As with many nitrogen-rich compounds, safety considerations regarding handling and storage are essential due to potential reactivity and toxicity.

Formula:C₃H₇N₅

InChI:InChI=1/C3H7N5/c1-2-8-6-3(4)5-7-8/h2H2,1H3,(H2,4,6)