
CAS 951122-93-3
:2-(Chloromethyl)-4-ethylbenzothiazole
Description:
2-(Chloromethyl)-4-ethylbenzothiazole is an organic compound characterized by its benzothiazole structure, which consists of a benzene ring fused to a thiazole ring. This compound features a chloromethyl group (-CH2Cl) and an ethyl group (-C2H5) attached to the benzothiazole framework, influencing its chemical reactivity and physical properties. Typically, compounds of this nature exhibit moderate to high lipophilicity due to the presence of aromatic and aliphatic groups, which can affect their solubility in organic solvents. The chloromethyl group can serve as a reactive site for further chemical modifications, making it useful in synthetic organic chemistry. Additionally, benzothiazole derivatives are known for their applications in pharmaceuticals, agrochemicals, and materials science, often exhibiting biological activity. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 2-(Chloromethyl)-4-ethylbenzothiazole is a versatile compound with potential applications in various chemical fields.
Formula:C10H10ClNS
InChI:InChI=1S/C10H10ClNS/c1-2-7-4-3-5-8-10(7)12-9(6-11)13-8/h3-5H,2,6H2,1H3
InChI key:InChIKey=GUCUQDMYLJUMIA-UHFFFAOYSA-N
SMILES:C(C)C1=C2C(SC(CCl)=N2)=CC=C1
Synonyms:- 2-(Chloromethyl)-4-ethylbenzo[d]thiazole
- Benzothiazole, 2-(chloromethyl)-4-ethyl-
- 2-(Chloromethyl)-4-ethyl-1,3-benzothiazole
- 2-(Chloromethyl)-4-ethylbenzothiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.