CAS 951131-10-5

10H-Phenothiazine-3,7-diamine, N3,N3,N7,N7-tetramethyl-, hydrochloride (1:2)

Description:

10H-Phenothiazine-3,7-diamine, N3,N3,N7,N7-tetramethyl-, hydrochloride (1:2) is a chemical compound characterized by its phenothiazine backbone, which is a tricyclic structure known for its applications in pharmaceuticals, particularly as antipsychotic agents. This specific compound features four methyl groups attached to the nitrogen atoms at the 3 and 7 positions of the phenothiazine ring, enhancing its solubility and potentially influencing its biological activity. The hydrochloride form indicates that the compound is a salt, which often improves stability and solubility in aqueous solutions. Its molecular structure contributes to its properties, including potential interactions with neurotransmitter systems, making it of interest in medicinal chemistry. The compound's CAS number, 951131-10-5, allows for precise identification in chemical databases. As with many phenothiazine derivatives, it may exhibit various pharmacological effects, but specific biological activities would require further investigation through empirical studies. Safety and handling precautions should be observed due to the potential for toxicity associated with phenothiazine derivatives.

Formula: C₁₆H₁₉N₃S·2ClH

InChI: InChI=1S/C16H19N3S.2ClH/c1-18(2)11-5-7-13-15(9-11)20-16-10-12(19(3)4)6-8-14(16)17-13;;/h5-10,17H,1-4H3;2*1H

InChI key: InChIKey=VRFVVNNSIGKEJY-UHFFFAOYSA-N

SMILES: N(C)(C)C=1C=C2C(NC=3C(S2)=CC(N(C)C)=CC3)=CC1.Cl

Synonyms:

• 10H-Phenothiazine-3,7-diamine, N3,N3,N7,N7-tetramethyl-, hydrochloride (1:2)